cas: 126937-43-7 — see every product listed under this CAS number, including other names
1-Benzyl 2-methyl piperazine-1,2-dicarboxylate, 97%, 97% (CAS 126937-43-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WFN-100mg |
| cas | 126937-43-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 957.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate (CAS 126937-43-7) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate. InChIKey: HOLPEQRNMJTIIX-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate |
| InChIKey | HOLPEQRNMJTIIX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)