Products 1048343-57-2
CAS 1048343-57-2 appears in our catalog under these names: 2-(2,7-Dimethyl-1h-indol-3-yl)ethanamine oxalate, 95%, 2-(2,7-Dimethyl-1H-indol-3-yl)ethanamine oxalic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 25g, 1g.
2-(2,7-dimethyl-1H-indol-3-yl)ethanamine;oxalic acid (CAS 1048343-57-2) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 2-(2,7-dimethyl-1H-indol-3-yl)ethanamine;oxalic acid. InChIKey: KGLPRFLCYRTDCT-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-(2,7-dimethyl-1H-indol-3-yl)ethanamine;oxalic acid |
| InChIKey | KGLPRFLCYRTDCT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(N2)C)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)