CAS 126937-43-7 appears in our catalog under these names: (R)-1-N-Cbz-piperazine-2-carboxylic acid methyl ester, 95%, 1-benzyl 2-methyl piperazine-1,2-dicarboxylate, 97%, 1–Benzyl 2–methyl piperazine–1,2–dicarboxylate, 1-Benzyl 2-methyl piperazine-1,2-dicarboxylate 97%, 1-Benzyl 2-methyl piperazine-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate (CAS 126937-43-7) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate. InChIKey: HOLPEQRNMJTIIX-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate |
| InChIKey | HOLPEQRNMJTIIX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)