Products 1394840-24-4
CAS 1394840-24-4 appears in our catalog under these names: 2-Benzyl-2,6-diazaspiro[3.3]heptane oxalate, 95%, 2-Benzyl-2,6-diazaspiro(3.3)heptane oxalate, 97%, 2–Benzyl–2，6–diazaspiro(3·3)heptane oxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 250mg, 1g, 5g.
2-benzyl-2,6-diazaspiro[3.3]heptane;oxalic acid (CAS 1394840-24-4) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 2-benzyl-2,6-diazaspiro[3.3]heptane;oxalic acid. InChIKey: DOBOTFSJYCPDOS-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-benzyl-2,6-diazaspiro[3.3]heptane;oxalic acid |
| InChIKey | DOBOTFSJYCPDOS-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)CC3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)