CAS 119137-03-0 appears in our catalog under these names: 2-Nitrobenzyl cyclohexylcarbamate, 95%, 2–Nitrobenzyl Cyclohexylcarbamate, 2-Nitrobenzyl Cyclohexylcarbamate, >98.0%(HPLC)(N), 2-Nitrobenzyl Cyclohexylcarbamate, ≥98%, ≥98%, 2-Nitrobenzyl cyclohexylcarbamate. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(2-nitrophenyl)methyl N-cyclohexylcarbamate (CAS 119137-03-0) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: (2-nitrophenyl)methyl N-cyclohexylcarbamate. InChIKey: NJMCHQONLVUNAM-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | (2-nitrophenyl)methyl N-cyclohexylcarbamate |
| InChIKey | NJMCHQONLVUNAM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)OCC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)