cas: 115655-42-0 — see every product listed under this CAS number, including other names
1-Benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate, 97% (CAS 115655-42-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A673905-25g |
| cas | 115655-42-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 6540.94 Pln | |
| Fluorochem | 500mg | 357.18 Pln | |
| Fluorochem | 1g | 560.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate (CAS 115655-42-0) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: 1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate. InChIKey: PLQPYSJTFRDBOT-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate |
| InChIKey | PLQPYSJTFRDBOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN(CC1)C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)