cas: 226989-35-1 — see every product listed under this CAS number, including other names
1-Benzyl-1H-pyrazol-4-ol 95% (CAS 226989-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205612-100mg |
| cas | 226989-35-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 604.00 Pln | |
| Ambeed | 250mg | 976.69 Pln | |
| Ambeed | 1g | 1939.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A205612 |
1-benzylpyrazol-4-ol (CAS 226989-35-1) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 1-benzylpyrazol-4-ol. InChIKey: BELUNASLYMZLPW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1-benzylpyrazol-4-ol |
| InChIKey | BELUNASLYMZLPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)O |
Computed by PubChem (NCBI)