cas: 226989-35-1 — see every product listed under this CAS number, including other names
1-Benzyl-1H-pyrazol-4-ol, 97% (CAS 226989-35-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546614-50MG |
| cas | 226989-35-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 388.42 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 1934.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-benzylpyrazol-4-ol (CAS 226989-35-1) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 1-benzylpyrazol-4-ol. InChIKey: BELUNASLYMZLPW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1-benzylpyrazol-4-ol |
| InChIKey | BELUNASLYMZLPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)O |
Computed by PubChem (NCBI)