cas: 226989-35-1 — see every product listed under this CAS number, including other names
1-Benzyl-1H-pyrazol-4-ol, 95%, 95% (CAS 226989-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BGWX-100mg |
| cas | 226989-35-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 779.60 Pln | |
| Chemat | 1g | 1547.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzylpyrazol-4-ol (CAS 226989-35-1) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 1-benzylpyrazol-4-ol. InChIKey: BELUNASLYMZLPW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1-benzylpyrazol-4-ol |
| InChIKey | BELUNASLYMZLPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)O |
Computed by PubChem (NCBI)