cas: 105973-51-1 — see every product listed under this CAS number, including other names
1-Benzyl-3-piperidinol hydrochloride, 97% (CAS 105973-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | AC13425DA |
| cas | 105973-51-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 151.20 Pln | |
| Thermo Scientific | 10g | 428.65 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-benzylpiperidin-3-ol;hydrochloride (CAS 105973-51-1) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 1-benzylpiperidin-3-ol;hydrochloride. InChIKey: PHJDPNCYJSWYGY-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 1-benzylpiperidin-3-ol;hydrochloride |
| InChIKey | PHJDPNCYJSWYGY-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)