cas: 105973-51-1 — see every product listed under this CAS number, including other names
1-Benzyl-3-piperidinol hydrochloride, 98+%, 98+% (CAS 105973-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E1L-1g |
| cas | 105973-51-1 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 606.80 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
1-benzylpiperidin-3-ol;hydrochloride (CAS 105973-51-1) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 1-benzylpiperidin-3-ol;hydrochloride. InChIKey: PHJDPNCYJSWYGY-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 1-benzylpiperidin-3-ol;hydrochloride |
| InChIKey | PHJDPNCYJSWYGY-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)