cas: 105973-51-1 — see every product listed under this CAS number, including other names
1-Benzylpiperidin-3-ol hydrochloride, 95% (CAS 105973-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218925-1G |
| cas | 105973-51-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 25g | 310.33 Pln | |
| Fluorochem | 100g | 924.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-benzylpiperidin-3-ol;hydrochloride (CAS 105973-51-1) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 1-benzylpiperidin-3-ol;hydrochloride. InChIKey: PHJDPNCYJSWYGY-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 1-benzylpiperidin-3-ol;hydrochloride |
| InChIKey | PHJDPNCYJSWYGY-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)