cas: 88095-61-8 — see every product listed under this CAS number, including other names
1-Benzyl-4-nitro-1H-pyrazole 97% (CAS 88095-61-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262393-1g |
| cas | 88095-61-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 542.81 Pln | |
| Ambeed | 100g | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A262393 |
1-benzyl-4-nitropyrazole (CAS 88095-61-8) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-benzyl-4-nitropyrazole. InChIKey: IYZHZCMFLIKMSN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-benzyl-4-nitropyrazole |
| InChIKey | IYZHZCMFLIKMSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)