cas: 154195-30-9 — see every product listed under this CAS number, including other names
1-Benzylazepane-2,5-dione 95% (CAS 154195-30-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112260-100mg |
| cas | 154195-30-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1065.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112260 |
1-benzylazepane-2,5-dione (CAS 154195-30-9) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 1-benzylazepane-2,5-dione. InChIKey: CTOCTUGUWVAJRP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 1-benzylazepane-2,5-dione |
| InChIKey | CTOCTUGUWVAJRP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(CCC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)