CAS 6777-05-5 appears in our catalog under these names: 1-Benzylhydantoin, >98.0%(GC), 1-Benzylhydantoin 98%, N-Benzylhydantoin, 98%, 98%. Offered by: TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g.
1-benzylimidazolidine-2,4-dione (CAS 6777-05-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1-benzylimidazolidine-2,4-dione. InChIKey: VJUNTPRQTFDQMF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1-benzylimidazolidine-2,4-dione |
| InChIKey | VJUNTPRQTFDQMF-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=O)N1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)