CAS 1936317-68-8 appears in our catalog under these names: 6-Methoxy-7-methyl-1h-[1,5]naphthyridin-4-one, 95%, 6-Methoxy-7-methyl-1,5-naphthyridin-4(1H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-methoxy-7-methyl-1H-1,5-naphthyridin-4-one (CAS 1936317-68-8) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 6-methoxy-7-methyl-1H-1,5-naphthyridin-4-one. InChIKey: KXFDRSQQOJXCIV-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 6-methoxy-7-methyl-1H-1,5-naphthyridin-4-one |
| InChIKey | KXFDRSQQOJXCIV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=O)C=CN2)N=C1OC |
Computed by PubChem (NCBI)