Products 80971-96-6
CAS 80971-96-6 is the registry number for 3-Amino-3-(3-cyanophenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-amino-3-(3-cyanophenyl)propanoic acid (CAS 80971-96-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 3-amino-3-(3-cyanophenyl)propanoic acid. InChIKey: RRUDIPCLABXNDE-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3-amino-3-(3-cyanophenyl)propanoic acid |
| InChIKey | RRUDIPCLABXNDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(CC(=O)O)N)C#N |
Computed by PubChem (NCBI)
Synonyms:
3-amino-3-(3-cyanophenyl)propanoic Acid, 3-amino-3-(3-cyanophenyl)propionic acid, (R)-3-Amino-3-(3-cyanophenyl)propionic acid, (R)-H-beta-Phe(3-CN)-OH, RRUDIPCLABXNDE-UHFFFAOYSA-N, 3-amino-3-(3-cyanophenyl)propionicacid, 3-amino-3-(3-cyano-phenyl)-propionic acid, 3-(cyano)-beta-(amino)benzene propanoic acid