CAS 1159833-34-7 appears in our catalog under these names: 3,6-Dimethylimidazo[1,2-a]pyridine-2-carboxylic acid, 95%, 3,6-Dimethylimidazo[1,2-a]pyridine-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,6-dimethylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 1159833-34-7) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 3,6-dimethylimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: FCAKFFOHEXKACL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3,6-dimethylimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | FCAKFFOHEXKACL-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(N=C2C=C1)C(=O)O)C |
Computed by PubChem (NCBI)