CAS 1824275-81-1 is the registry number for N-Methoxy-n-methylbenzo[b]azete-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
N-methoxy-N-methyl-7-azabicyclo[4.2.0]octa-1,3,5,7-tetraene-8-carboxamide (CAS 1824275-81-1) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: N-methoxy-N-methyl-7-azabicyclo[4.2.0]octa-1,3,5,7-tetraene-8-carboxamide. InChIKey: ORCXTPADSFQPHM-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | N-methoxy-N-methyl-7-azabicyclo[4.2.0]octa-1,3,5,7-tetraene-8-carboxamide |
| InChIKey | ORCXTPADSFQPHM-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=NC2=CC=CC=C21)OC |
Computed by PubChem (NCBI)