cas: 348640-11-9 — see every product listed under this CAS number, including other names
1-Boc-3-Bromo-5-methoxyindole, 97%, 97% (CAS 348640-11-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8IX-250mg |
| cas | 348640-11-9 |
| size | 250mg |
| availability | 29g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 515.60 Pln | |
| Chemat | 10g | 808.40 Pln | |
| Chemat | 25g | 1691.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-bromo-5-methoxyindole-1-carboxylate (CAS 348640-11-9) is a chemical compound with the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. IUPAC name: tert-butyl 3-bromo-5-methoxyindole-1-carboxylate. InChIKey: DCTZDUWRIAYEIF-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO3 |
|---|---|
| Molecular weight | 326.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-methoxyindole-1-carboxylate |
| InChIKey | DCTZDUWRIAYEIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)OC)Br |
Computed by PubChem (NCBI)