cas: 348640-11-9 — see every product listed under this CAS number, including other names
1-Boc-3-Bromo-5-methoxyindole, 97% (CAS 348640-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 250mg, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A276303-1g |
| cas | 348640-11-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 388.99 Pln | |
| AmBeed | 25g | 3116.68 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1002.79 Pln | |
| Fluorochem | 25g | 1950.37 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-bromo-5-methoxyindole-1-carboxylate (CAS 348640-11-9) is a chemical compound with the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. IUPAC name: tert-butyl 3-bromo-5-methoxyindole-1-carboxylate. InChIKey: DCTZDUWRIAYEIF-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO3 |
|---|---|
| Molecular weight | 326.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-methoxyindole-1-carboxylate |
| InChIKey | DCTZDUWRIAYEIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)OC)Br |
Computed by PubChem (NCBI)