cas: 281652-10-6 — see every product listed under this CAS number, including other names
1-Boc-4,4-difluoropiperidine 98% (CAS 281652-10-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A346139-1g |
| cas | 281652-10-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 859.88 Pln | |
| Ambeed | 100g | 3212.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A346139 |
Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS 281652-10-6) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: tert-butyl 4,4-difluoropiperidine-1-carboxylate. InChIKey: HHBBBPZPEBZLII-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO2 |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | tert-butyl 4,4-difluoropiperidine-1-carboxylate |
| InChIKey | HHBBBPZPEBZLII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(F)F |
Computed by PubChem (NCBI)