cas: 281652-10-6 — see every product listed under this CAS number, including other names
1-Boc-4,4-difluoropiperidine, 98%, 98% (CAS 281652-10-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFM8-10g |
| cas | 281652-10-6 |
| size | 10g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 280.40 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 25g | 530.00 Pln | |
| Chemat | 100g | 1576.40 Pln | |
| Chemat | 500g | 7699.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS 281652-10-6) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: tert-butyl 4,4-difluoropiperidine-1-carboxylate. InChIKey: HHBBBPZPEBZLII-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO2 |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | tert-butyl 4,4-difluoropiperidine-1-carboxylate |
| InChIKey | HHBBBPZPEBZLII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(F)F |
Computed by PubChem (NCBI)