cas: 1179338-62-5 — see every product listed under this CAS number, including other names
1-Boc-4-(2-aminoethyl)-4-hydroxypiperidine, 95% (CAS 1179338-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-3889-1g |
| cas | 1179338-62-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 500mg | 971.55 Pln | |
| Fluorochem | 1g | 1185.02 Pln | |
| Fluorochem | 5g | 4350.57 Pln | |
| Fluorochem | 10g | 8651.14 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 4-(2-aminoethyl)-4-hydroxypiperidine-1-carboxylate (CAS 1179338-62-5) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl 4-(2-aminoethyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: UYDYNQSSAMMVRM-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl 4-(2-aminoethyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | UYDYNQSSAMMVRM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CCN)O |
Computed by PubChem (NCBI)