cas: 1179338-62-5 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-aminoethyl)-4-hydroxypiperidine-1-carboxylate, 95%, 95% (CAS 1179338-62-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11885Z-100mg |
| cas | 1179338-62-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 500mg | 746.00 Pln | |
| Chemat | 1g | 1101.20 Pln | |
| Chemat | 5g | 3366.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(2-aminoethyl)-4-hydroxypiperidine-1-carboxylate (CAS 1179338-62-5) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl 4-(2-aminoethyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: UYDYNQSSAMMVRM-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl 4-(2-aminoethyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | UYDYNQSSAMMVRM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CCN)O |
Computed by PubChem (NCBI)