cas: 1049730-83-7 — see every product listed under this CAS number, including other names
1-Boc-5-Oxo-1,6-diazaspiro[3.4]octane, 97%, 97% (CAS 1049730-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118X9K-100mg |
| cas | 1049730-83-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1552.40 Pln | |
| Chemat | 250mg | 2440.40 Pln | |
| Chemat | 500mg | 4024.40 Pln | |
| Chemat | 1g | 6006.80 Pln | |
| Chemat | 5g | 17891.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 8-oxo-1,7-diazaspiro[3.4]octane-1-carboxylate (CAS 1049730-83-7) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl 8-oxo-1,7-diazaspiro[3.4]octane-1-carboxylate. InChIKey: NPGRDRVURHCUPW-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl 8-oxo-1,7-diazaspiro[3.4]octane-1-carboxylate |
| InChIKey | NPGRDRVURHCUPW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCNC2=O |
Computed by PubChem (NCBI)