cas: 1049730-83-7 — see every product listed under this CAS number, including other names
tert-Butyl 5-oxo-1,6-diazaspiro[3.4]octane-1-carboxylate, 97% (CAS 1049730-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F600114-100MG |
| cas | 1049730-83-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2543.91 Pln | |
| Fluorochem | 250mg | 4012.15 Pln | |
| Fluorochem | 500mg | 6636.22 Pln | |
| Fluorochem | 1g | 9921.52 Pln | |
| Fluorochem | 5g | 29612.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 8-oxo-1,7-diazaspiro[3.4]octane-1-carboxylate (CAS 1049730-83-7) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl 8-oxo-1,7-diazaspiro[3.4]octane-1-carboxylate. InChIKey: NPGRDRVURHCUPW-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl 8-oxo-1,7-diazaspiro[3.4]octane-1-carboxylate |
| InChIKey | NPGRDRVURHCUPW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCNC2=O |
Computed by PubChem (NCBI)