1-Boc-Nipecotic acid, 97.0%
cas: 84358-12-3 — see every product listed under this CAS number, including other names
1-Boc-Nipecotic acid, 97.0% (CAS 84358-12-3) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 500 g, 50 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-40014-25 g |
| cas | 84358-12-3 |
| size | 25 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 500 g | 719.08 Pln | |
| MedChemExpress | 50 g | 287.18 Pln | |
| MedChemExpress | 100 g | 361.49 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 84358-12-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: NXILIHONWRXHFA-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | NXILIHONWRXHFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-[(tert-butoxy)carbonyl]piperidine-3-carboxylic acid, 1-((Tert-butoxy)carbonyl)piperidine-3-carboxylic acid, 1-Boc-piperidine-3-carboxylic acid, 1-(tert-butoxycarbonyl)piperidine-3-carboxylic acid, 1-Boc-3-piperidinecarboxylic Acid, n-boc-nipecotic acid, Boc-DL-Nip-OH, 1-(tert-Butoxycarbonyl)-3-piperidinecarboxylic acid, 1-Boc-nipecotic Acid, n-boc-3-piperidinecarboxylic acid