cas: 84358-12-3 — see every product listed under this CAS number, including other names
1-tert-Butoxycarbonylpiperidine-3-carboxylic acid, 95% (CAS 84358-12-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019199-10G |
| cas | 84358-12-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 164.54 Pln | |
| Fluorochem | 500g | 591.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 84358-12-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: NXILIHONWRXHFA-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | NXILIHONWRXHFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C(=O)O |
Computed by PubChem (NCBI)