cas: 174913-19-0 — see every product listed under this CAS number, including other names
1-Bromo-2,3-dichloro-5-methoxybenzene, 98%, 98% (CAS 174913-19-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12L428-100mg |
| cas | 174913-19-0 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 726.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,3-dichloro-5-methoxybenzene (CAS 174913-19-0) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: 1-bromo-2,3-dichloro-5-methoxybenzene. InChIKey: BVZMVWRQCWSDSK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | 1-bromo-2,3-dichloro-5-methoxybenzene |
| InChIKey | BVZMVWRQCWSDSK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)