CAS 115615-21-9 is the registry number for (2-Bromo-4,6-dichlorophenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(2-bromo-4,6-dichlorophenyl)methanol (CAS 115615-21-9) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: (2-bromo-4,6-dichlorophenyl)methanol. InChIKey: KKRGKPLATYTQGP-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | (2-bromo-4,6-dichlorophenyl)methanol |
| InChIKey | KKRGKPLATYTQGP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CO)Br)Cl |
Computed by PubChem (NCBI)