CAS 1807009-09-1 appears in our catalog under these names: 6-Bromo-2,3-dichlorobenzyl alcohol, 95%, 6-Bromo-2,3-dichlorobenzyl alcohol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(6-bromo-2,3-dichlorophenyl)methanol (CAS 1807009-09-1) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: (6-bromo-2,3-dichlorophenyl)methanol. InChIKey: ABGMWYMWAKJBLD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | (6-bromo-2,3-dichlorophenyl)methanol |
| InChIKey | ABGMWYMWAKJBLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)CO)Br |
Computed by PubChem (NCBI)