CAS 1805119-74-7 is the registry number for 3-Bromo-2,5-dichlorobenzyl alcohol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
(3-bromo-2,5-dichlorophenyl)methanol (CAS 1805119-74-7) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: (3-bromo-2,5-dichlorophenyl)methanol. InChIKey: HDFQKWVHMUFHJI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | (3-bromo-2,5-dichlorophenyl)methanol |
| InChIKey | HDFQKWVHMUFHJI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)Cl)Br)Cl |
Computed by PubChem (NCBI)