CAS 56037-74-2 is the registry number for 4-Bromo-2,6-dichloro-3-methylphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-bromo-2,6-dichloro-3-methylphenol (CAS 56037-74-2) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: 4-bromo-2,6-dichloro-3-methylphenol. InChIKey: SQCAINOXUYGYKI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | 4-bromo-2,6-dichloro-3-methylphenol |
| InChIKey | SQCAINOXUYGYKI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)O)Cl)Br |
Computed by PubChem (NCBI)