cas: 174913-17-8 — see every product listed under this CAS number, including other names
1-Bromo-2,5-dichloro-3-methoxybenzene (CAS 174913-17-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632665-1G |
| cas | 174913-17-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1731.70 Pln | |
| Fluorochem | 5g | 5058.65 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-2,5-dichloro-3-methoxybenzene (CAS 174913-17-8) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: 1-bromo-2,5-dichloro-3-methoxybenzene. InChIKey: JQSZULKEIVJVMD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | 1-bromo-2,5-dichloro-3-methoxybenzene |
| InChIKey | JQSZULKEIVJVMD-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)