cas: 167415-27-2 — see every product listed under this CAS number, including other names
1-Bromo-2,5-difluoro-4-nitrobenzene, 98%, 98% (CAS 167415-27-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112XD9-250mg |
| cas | 167415-27-2 |
| size | 250mg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 395.60 Pln | |
| Chemat | 500g | 1804.80 Pln | |
| Chemat | 1kg | 3525.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,5-difluoro-4-nitrobenzene (CAS 167415-27-2) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-nitrobenzene. InChIKey: GJFYMYJYPARISZ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-nitrobenzene |
| InChIKey | GJFYMYJYPARISZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)