cas: 167415-27-2 — see every product listed under this CAS number, including other names
4-Bromo-2,5-difluoronitrobenzene, 97% (CAS 167415-27-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005502-500G |
| cas | 167415-27-2 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500g | 2476.23 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 549.82 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
1-bromo-2,5-difluoro-4-nitrobenzene (CAS 167415-27-2) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-nitrobenzene. InChIKey: GJFYMYJYPARISZ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-nitrobenzene |
| InChIKey | GJFYMYJYPARISZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)