cas: 167415-27-2 — see every product listed under this CAS number, including other names
4-Bromo-2,5-difluoronitrobenzene, >98.0%(GC) (CAS 167415-27-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3926-1G |
| cas | 167415-27-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 113.43 Pln | |
| TCI | 5g | 383.88 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-bromo-2,5-difluoro-4-nitrobenzene (CAS 167415-27-2) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-nitrobenzene. InChIKey: GJFYMYJYPARISZ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-nitrobenzene |
| InChIKey | GJFYMYJYPARISZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)