1-Bromo-2-((4-fluorobenzyl)oxy)benzene, 97%
cas: 494772-43-9 — see every product listed under this CAS number, including other names
1-Bromo-2-((4-fluorobenzyl)oxy)benzene, 97% (CAS 494772-43-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A420138-250mg |
| cas | 494772-43-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 932.19 Pln | |
| Ambeed | 5g | 3146.06 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 408.77 Pln | |
| BLDpharm | 1g | 914.15 Pln | |
| BLDpharm | 5g | 3080.05 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 2776.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-bromo-2-[(4-fluorophenyl)methoxy]benzene (CAS 494772-43-9) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-bromo-2-[(4-fluorophenyl)methoxy]benzene. InChIKey: FXJVYYCNLTXKJZ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-bromo-2-[(4-fluorophenyl)methoxy]benzene |
| InChIKey | FXJVYYCNLTXKJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC=C(C=C2)F)Br |
Computed by PubChem (NCBI)
