CAS 247089-76-5 is the registry number for (3-Bromophenyl)(4-fluorophenyl)methanol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-bromophenyl)-(4-fluorophenyl)methanol (CAS 247089-76-5) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: (3-bromophenyl)-(4-fluorophenyl)methanol. InChIKey: YBUFCLFBGOTIMD-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | (3-bromophenyl)-(4-fluorophenyl)methanol |
| InChIKey | YBUFCLFBGOTIMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)