CAS 65295-58-1 appears in our catalog under these names: 1-(Bromomethyl)-3-(4-fluorophenoxy)benzene, 95+%, 3-(4-Fluorophenoxy)benzyl bromide, 95%, 3-(4-Fluorophenoxy)benzyl Bromide, >97.0%(GC), 3-(4-Fluorophenoxy)benzyl Bromide, 97%, 97%, 3-(4-Fluorophenoxy)benzyl bromide, 97%. Offered by: AmBeed, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 500mg.
1-(bromomethyl)-3-(4-fluorophenoxy)benzene (CAS 65295-58-1) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-(bromomethyl)-3-(4-fluorophenoxy)benzene. InChIKey: JGFSTQUUDSBQCO-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(4-fluorophenoxy)benzene |
| InChIKey | JGFSTQUUDSBQCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)F)CBr |
Computed by PubChem (NCBI)