CAS 900911-39-9 appears in our catalog under these names: 4-Bromophenyl-(4-fluorobenzyl)ether, 95%, 1–Bromo–4–((4–fluorobenzyl)oxy)benzene, 4-Bromophenyl-(4-fluorobenzyl)ether. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-bromo-4-[(4-fluorophenyl)methoxy]benzene (CAS 900911-39-9) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-bromo-4-[(4-fluorophenyl)methoxy]benzene. InChIKey: RKQAIWHMXGWHRT-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-bromo-4-[(4-fluorophenyl)methoxy]benzene |
| InChIKey | RKQAIWHMXGWHRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)