CAS 944645-38-9 appears in our catalog under these names: (4-Bromophenyl)(3-fluorophenyl)methanol, 98%, Benzenemethanol, 4-bromo-α-(3-fluorophenyl)-, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(4-bromophenyl)-(3-fluorophenyl)methanol (CAS 944645-38-9) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: (4-bromophenyl)-(3-fluorophenyl)methanol. InChIKey: DYEJGILJRSUTDH-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | (4-bromophenyl)-(3-fluorophenyl)methanol |
| InChIKey | DYEJGILJRSUTDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)