1-Bromo-2-naphthoic acid 97%
cas: 20717-79-7 — see every product listed under this CAS number, including other names
1-Bromo-2-naphthoic acid 97% (CAS 20717-79-7) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262360-1000g |
| cas | 20717-79-7 |
| size | 1000g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 12680.19 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 342.56 Pln | |
| Ambeed | 25g | 531.69 Pln | |
| Ambeed | 100g | 1850.00 Pln | |
| Ambeed | 500g | 7952.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A262360 |
1-bromonaphthalene-2-carboxylic acid (CAS 20717-79-7) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 1-bromonaphthalene-2-carboxylic acid. InChIKey: VUVIRKAVBZITDO-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 1-bromonaphthalene-2-carboxylic acid |
| InChIKey | VUVIRKAVBZITDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2Br)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Bromo-2-naphthoic acid, 1-Bromo-2-naphthalenecarboxylic Acid, 1-bromonaphthalene-2-carboxylic acid, 2-Naphthalenecarboxylic acid, 1-bromo-, Maybridge4_002377, 1-Bromo-na, 1-bromo-2-napthoic acid, 1-(4-Fluorophenyl)-4-(4-hydroxy-4-p-tolylpiperidin-1-yl)butan-1-one, 1-Bromo-naphthalene-2-carboxylic acid