cas: 20717-79-7 — see every product listed under this CAS number, including other names
1-Bromo-2-naphthoic Acid, >98.0%(GC)(T) (CAS 20717-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1617-100MG |
| cas | 20717-79-7 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 98.68 Pln | |
| TCI | 1g | 437.97 Pln | |
| TCI | 5g | 1357.49 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
1-bromonaphthalene-2-carboxylic acid (CAS 20717-79-7) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 1-bromonaphthalene-2-carboxylic acid. InChIKey: VUVIRKAVBZITDO-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 1-bromonaphthalene-2-carboxylic acid |
| InChIKey | VUVIRKAVBZITDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2Br)C(=O)O |
Computed by PubChem (NCBI)