cas: 1242339-23-6 — see every product listed under this CAS number, including other names
1-Bromo-3,4-difluoro-2-(trifluoromethyl)benzene 98% (CAS 1242339-23-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160102-100g |
| cas | 1242339-23-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 8280.25 Pln | |
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 25g | 2634.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A160102 |
1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene (CAS 1242339-23-6) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene. InChIKey: DKRBFARXIWUPMN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | DKRBFARXIWUPMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)