cas: 1242339-23-6 — see every product listed under this CAS number, including other names
6-Bromo-2,3-difluorobenzotrifluoride, 98% (CAS 1242339-23-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044286-100MG |
| cas | 1242339-23-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 857.01 Pln | |
| Fluorochem | 25g | 2564.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene (CAS 1242339-23-6) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene. InChIKey: DKRBFARXIWUPMN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | DKRBFARXIWUPMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)