cas: 1242339-23-6 — see every product listed under this CAS number, including other names
1-Bromo-3,4-difluoro-2-(trifluoromethyl)benzene, 98%, 98% (CAS 1242339-23-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110F95-100mg |
| cas | 1242339-23-6 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 50g | 4197.20 Pln | |
| Chemat | 100g | 6266.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene (CAS 1242339-23-6) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene. InChIKey: DKRBFARXIWUPMN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | DKRBFARXIWUPMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)