cas: 1379358-18-5 — see every product listed under this CAS number, including other names
1-Bromo-3,5-dimethoxy-2-nitrobenzene, 97%, 97% (CAS 1379358-18-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HV60-100mg |
| cas | 1379358-18-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 290.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3,5-dimethoxy-2-nitrobenzene (CAS 1379358-18-5) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: 1-bromo-3,5-dimethoxy-2-nitrobenzene. InChIKey: KODPKAQPETYBEG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 1-bromo-3,5-dimethoxy-2-nitrobenzene |
| InChIKey | KODPKAQPETYBEG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)