CAS 1435943-60-4 is the registry number for 2-Bromo-1,3-dimethoxy-4-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-1,3-dimethoxy-4-nitrobenzene (CAS 1435943-60-4) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: 2-bromo-1,3-dimethoxy-4-nitrobenzene. InChIKey: MYWPCIPGSXEIJB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 2-bromo-1,3-dimethoxy-4-nitrobenzene |
| InChIKey | MYWPCIPGSXEIJB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)[N+](=O)[O-])OC)Br |
Computed by PubChem (NCBI)